C35H44N2O3 — CID 66626307
N-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-5-methoxy-2-(6-methoxy-3,3-dimethyl-4H-naphthalen-2-yl)aniline (PubChem CID 66626307) has the molecular formula C35H44N2O3 and a molecular weight of 540.75 g/mol. Its IUPAC name is N-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-5-methoxy-2-(6-methoxy-3,3-dimethyl-4H-naphthalen-2-yl)aniline.
| Compound Name | N-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-5-methoxy-2-(6-methoxy-3,3-dimethyl-4H-naphthalen-2-yl)aniline |
|---|---|
| PubChem CID | 66626307 |
| Molecular Formula | C35H44N2O3 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.34 |
| IUPAC Name | N-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-5-methoxy-2-(6-methoxy-3,3-dimethyl-4H-naphthalen-2-yl)aniline |
| SMILES | COc1ccc2c(c1)CC(C)(C)C(c1ccc(OC)cc1NCc1ccc(OCCN3CCCCCC3)cc1)=C2 |
| InChI | InChI=1S/C35H44N2O3/c1-35(2)24-28-21-30(38-3)14-11-27(28)22-33(35)32-16-15-31(39-4)23-34(32)36-25-26-9-12-29(13-10-26)40-20-19-37-17-7-5-6-8-18-37/h9-16,21-23,36H,5-8,17-20,24-25H2,1-4H3 |
| InChIKey | XYXKMJNQCLVULJ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|