About 2,3-diphenylporphyrin
2,3-diphenylporphyrin (PubChem CID 66626626) has the molecular formula C32H20N4
and a molecular weight of 460.54 g/mol. Its IUPAC name is 2,3-diphenylporphyrin.
Molecular Properties
| Compound Name | 2,3-diphenylporphyrin |
| PubChem CID | 66626626 |
| Molecular Formula | C32H20N4 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2,3-diphenylporphyrin |
| SMILES | C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C(c1ccccc1)=C4c1ccccc1)C=C3 |
| InChI | InChI=1S/C32H20N4/c1-3-7-21(8-4-1)31-29-19-27-15-13-25(34-27)17-23-11-12-24(33-23)18-26-14-16-28(35-26)20-30(36-29)32(31)22-9-5-2-6-10-22/h1-20H/b23-17-,24-18-,25-17-,26-18-,27-19-,28-20-,29-19-,30-20- |
| InChIKey | ZKBLRZKNQWWMJI-CGQXNKQUSA-N |
| XLogP | 6.63 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diphenylporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphenylporphyrin?
The IUPAC name of 2,3-diphenylporphyrin (CID 66626626) is 2,3-diphenylporphyrin.
What is the SMILES notation for 2,3-diphenylporphyrin?
The canonical SMILES for 2,3-diphenylporphyrin is C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C(c1ccccc1)=C4c1ccccc1)C=C3.
What is the InChIKey of 2,3-diphenylporphyrin?
The InChIKey is ZKBLRZKNQWWMJI-CGQXNKQUSA-N. The full InChI is InChI=1S/C32H20N4/c1-3-7-21(8-4-1)31-29-19-27-15-13-25(34-27)17-23-11-12-24(33-23)18-26-14-16-28(35-26)20-30(36-29)32(31)22-9-5-2-6-10-22/h1-20H/b23-17-,24-18-,25-17-,26-18-,27-19-,28-20-,29-19-,30-20-.
What are the key properties of 2,3-diphenylporphyrin?
2,3-diphenylporphyrin has a molecular weight of 460.54 g/mol, XLogP of 6.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenylporphyrin is sourced from PubChem (CID 66626626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).