C48H52N4 — CID 66626949
2,3-bis(3,5-ditert-butylphenyl)porphyrin (PubChem CID 66626949) has the molecular formula C48H52N4 and a molecular weight of 684.97 g/mol. Its IUPAC name is 2,3-bis(3,5-ditert-butylphenyl)porphyrin.
| Compound Name | 2,3-bis(3,5-ditert-butylphenyl)porphyrin |
|---|---|
| PubChem CID | 66626949 |
| Molecular Formula | C48H52N4 |
| Molecular Weight | 684.97 g/mol |
| Exact Mass | 684.42 |
| IUPAC Name | 2,3-bis(3,5-ditert-butylphenyl)porphyrin |
| SMILES | CC(C)(C)c1cc(C2=C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)/C3=C/C4=N/C(=C\C5=N/C(=C\C6=N/C(=C\C2=N3)C=C6)C=C5)C=C4)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C48H52N4/c1-45(2,3)31-19-29(20-32(23-31)46(4,5)6)43-41-27-39-17-15-37(50-39)25-35-13-14-36(49-35)26-38-16-18-40(51-38)28-42(52-41)44(43)30-21-33(47(7,8)9)24-34(22-30)48(10,11)12/h13-28H,1-12H3/b35-25-,36-26-,37-25-,38-26-,39-27-,40-28-,41-27-,42-28- |
| InChIKey | JQWZKMKOGFVGBR-RVMQIPTESA-N |
| XLogP | 11.82 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.97 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|