C34H46N2O3 — CID 66627966
6-[2-[ethyl-[[4-[2-(3-methylbutylamino)ethyl]phenyl]methyl]amino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 66627966) has the molecular formula C34H46N2O3 and a molecular weight of 530.75 g/mol. Its IUPAC name is 6-[2-[ethyl-[[4-[2-(3-methylbutylamino)ethyl]phenyl]methyl]amino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 6-[2-[ethyl-[[4-[2-(3-methylbutylamino)ethyl]phenyl]methyl]amino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 66627966 |
| Molecular Formula | C34H46N2O3 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.35 |
| IUPAC Name | 6-[2-[ethyl-[[4-[2-(3-methylbutylamino)ethyl]phenyl]methyl]amino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | CCN(Cc1ccc(CCNCCC(C)C)cc1)c1cc(OC)c(OC)cc1C1CCc2cc(O)ccc2C1 |
| InChI | InChI=1S/C34H46N2O3/c1-6-36(23-26-9-7-25(8-10-26)16-18-35-17-15-24(2)3)32-22-34(39-5)33(38-4)21-31(32)29-12-11-28-20-30(37)14-13-27(28)19-29/h7-10,13-14,20-22,24,29,35,37H,6,11-12,15-19,23H2,1-5H3 |
| InChIKey | FBPOOQWDNGOHIW-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|