About (2S)-2-(3,3-dimethylbut-1-ynyl)pyrrolidine-1-carboxylic acid
(2S)-2-(3,3-dimethylbut-1-ynyl)pyrrolidine-1-carboxylic acid (PubChem CID 66628340) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is (2S)-2-(3,3-dimethylbut-1-ynyl)pyrrolidine-1-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-2-(3,3-dimethylbut-1-ynyl)pyrrolidine-1-carboxylic acid |
| PubChem CID | 66628340 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (2S)-2-(3,3-dimethylbut-1-ynyl)pyrrolidine-1-carboxylic acid |
| SMILES | CC(C)(C)C#C[C@@H]1CCCN1C(=O)O |
| InChI | InChI=1S/C11H17NO2/c1-11(2,3)7-6-9-5-4-8-12(9)10(13)14/h9H,4-5,8H2,1-3H3,(H,13,14)/t9-/m0/s1 |
| InChIKey | TVKCEFGHPFDESF-VIFPVBQESA-N |
| XLogP | 2.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(3,3-dimethylbut-1-ynyl)pyrrolidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(3,3-dimethylbut-1-ynyl)pyrrolidine-1-carboxylic acid?
The IUPAC name of (2S)-2-(3,3-dimethylbut-1-ynyl)pyrrolidine-1-carboxylic acid (CID 66628340) is (2S)-2-(3,3-dimethylbut-1-ynyl)pyrrolidine-1-carboxylic acid.
What is the SMILES notation for (2S)-2-(3,3-dimethylbut-1-ynyl)pyrrolidine-1-carboxylic acid?
The canonical SMILES for (2S)-2-(3,3-dimethylbut-1-ynyl)pyrrolidine-1-carboxylic acid is CC(C)(C)C#C[C@@H]1CCCN1C(=O)O.
What is the InChIKey of (2S)-2-(3,3-dimethylbut-1-ynyl)pyrrolidine-1-carboxylic acid?
The InChIKey is TVKCEFGHPFDESF-VIFPVBQESA-N. The full InChI is InChI=1S/C11H17NO2/c1-11(2,3)7-6-9-5-4-8-12(9)10(13)14/h9H,4-5,8H2,1-3H3,(H,13,14)/t9-/m0/s1.
What are the key properties of (2S)-2-(3,3-dimethylbut-1-ynyl)pyrrolidine-1-carboxylic acid?
(2S)-2-(3,3-dimethylbut-1-ynyl)pyrrolidine-1-carboxylic acid has a molecular weight of 195.26 g/mol, XLogP of 2.18, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(3,3-dimethylbut-1-ynyl)pyrrolidine-1-carboxylic acid is sourced from PubChem (CID 66628340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).