C26H27ClN4O3S — CID 66628424
2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;1,2-diphenylethane-1,2-dione;chloride (PubChem CID 66628424) has the molecular formula C26H27ClN4O3S and a molecular weight of 511.05 g/mol. Its IUPAC name is 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;1,2-diphenylethane-1,2-dione;chloride.
| Compound Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;1,2-diphenylethane-1,2-dione;chloride |
|---|---|
| PubChem CID | 66628424 |
| Molecular Formula | C26H27ClN4O3S |
| Molecular Weight | 511.05 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;1,2-diphenylethane-1,2-dione;chloride |
| SMILES | Cc1ncc(C[n+]2csc(CCO)c2C)c(N)n1.O=C(C(=O)c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C14H10O2.C12H17N4OS.ClH/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;/h1-10H;5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);1H/q;+1;/p-1 |
| InChIKey | VOSYLRGSNQXNNZ-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.05 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|