C23H26FN5O5 — CID 66628548
(E)-but-2-enedioic acid;2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-5-[1-(2-fluoroethyl)indol-6-yl]-1,3,4-oxadiazole (PubChem CID 66628548) has the molecular formula C23H26FN5O5 and a molecular weight of 471.49 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-5-[1-(2-fluoroethyl)indol-6-yl]-1,3,4-oxadiazole.
| Compound Name | (E)-but-2-enedioic acid;2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-5-[1-(2-fluoroethyl)indol-6-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 66628548 |
| Molecular Formula | C23H26FN5O5 |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-5-[1-(2-fluoroethyl)indol-6-yl]-1,3,4-oxadiazole |
| SMILES | FCCn1ccc2ccc(-c3nnc(N4CCN5CCC4CC5)o3)cc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H22FN5O.C4H4O4/c20-6-10-24-9-3-14-1-2-15(13-17(14)24)18-21-22-19(26-18)25-12-11-23-7-4-16(25)5-8-23;5-3(6)1-2-4(7)8/h1-3,9,13,16H,4-8,10-12H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ASYRKXXAAUBOLF-WLHGVMLRSA-N |
| XLogP | 2.66 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|