About 3-fluorooxan-4-amine
3-fluorooxan-4-amine (PubChem CID 66628594) has the molecular formula C5H10FNO
and a molecular weight of 119.14 g/mol. Its IUPAC name is 3-fluorooxan-4-amine.
Molecular Properties
| Compound Name | 3-fluorooxan-4-amine |
| PubChem CID | 66628594 |
| Molecular Formula | C5H10FNO |
| Molecular Weight | 119.14 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 3-fluorooxan-4-amine |
| SMILES | NC1CCOCC1F |
| InChI | InChI=1S/C5H10FNO/c6-4-3-8-2-1-5(4)7/h4-5H,1-3,7H2 |
| InChIKey | RTWSYKYQHQVELW-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.14 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluorooxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluorooxan-4-amine?
The IUPAC name of 3-fluorooxan-4-amine (CID 66628594) is 3-fluorooxan-4-amine.
What is the SMILES notation for 3-fluorooxan-4-amine?
The canonical SMILES for 3-fluorooxan-4-amine is NC1CCOCC1F.
What is the InChIKey of 3-fluorooxan-4-amine?
The InChIKey is RTWSYKYQHQVELW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10FNO/c6-4-3-8-2-1-5(4)7/h4-5H,1-3,7H2.
What are the key properties of 3-fluorooxan-4-amine?
3-fluorooxan-4-amine has a molecular weight of 119.14 g/mol, XLogP of 0.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluorooxan-4-amine is sourced from PubChem (CID 66628594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).