C16H17N7OS — CID 666289
13-ethyl-N-(furan-2-ylmethyl)-16-thia-2,3,4,5,7,13-hexazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,7,10(15)-pentaen-8-amine (PubChem CID 666289) has the molecular formula C16H17N7OS and a molecular weight of 355.43 g/mol. Its IUPAC name is 13-ethyl-N-(furan-2-ylmethyl)-16-thia-2,3,4,5,7,13-hexazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,7,10(15)-pentaen-8-amine.
| Compound Name | 13-ethyl-N-(furan-2-ylmethyl)-16-thia-2,3,4,5,7,13-hexazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,7,10(15)-pentaen-8-amine |
|---|---|
| PubChem CID | 666289 |
| Molecular Formula | C16H17N7OS |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 13-ethyl-N-(furan-2-ylmethyl)-16-thia-2,3,4,5,7,13-hexazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,7,10(15)-pentaen-8-amine |
| SMILES | CCN1CCc2c(sc3c2c(NCc2ccco2)nc2nnnn23)C1 |
| InChI | InChI=1S/C16H17N7OS/c1-2-22-6-5-11-12(9-22)25-15-13(11)14(17-8-10-4-3-7-24-10)18-16-19-20-21-23(15)16/h3-4,7H,2,5-6,8-9H2,1H3,(H,17,18,19,21) |
| InChIKey | PTJPHLOIVZIECA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |