C17H21IN4O2 — CID 66629137
tert-butyl 2-[3-(4-iodophenyl)-1H-1,2,4-triazol-5-yl]pyrrolidine-1-carboxylate (PubChem CID 66629137) has the molecular formula C17H21IN4O2 and a molecular weight of 440.29 g/mol. Its IUPAC name is tert-butyl 2-[3-(4-iodophenyl)-1H-1,2,4-triazol-5-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-(4-iodophenyl)-1H-1,2,4-triazol-5-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66629137 |
| Molecular Formula | C17H21IN4O2 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | tert-butyl 2-[3-(4-iodophenyl)-1H-1,2,4-triazol-5-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1nc(-c2ccc(I)cc2)n[nH]1 |
| InChI | InChI=1S/C17H21IN4O2/c1-17(2,3)24-16(23)22-10-4-5-13(22)15-19-14(20-21-15)11-6-8-12(18)9-7-11/h6-9,13H,4-5,10H2,1-3H3,(H,19,20,21) |
| InChIKey | KBSQNPFZMNKJAR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|