C26H20N6 — CID 66629415
4-methyl-11-phenyl-12-[4-(pyrazol-1-ylmethyl)phenyl]-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene (PubChem CID 66629415) has the molecular formula C26H20N6 and a molecular weight of 416.49 g/mol. Its IUPAC name is 4-methyl-11-phenyl-12-[4-(pyrazol-1-ylmethyl)phenyl]-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene.
| Compound Name | 4-methyl-11-phenyl-12-[4-(pyrazol-1-ylmethyl)phenyl]-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 66629415 |
| Molecular Formula | C26H20N6 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-methyl-11-phenyl-12-[4-(pyrazol-1-ylmethyl)phenyl]-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
| SMILES | Cc1cc2ncc3cc(-c4ccccc4)c(-c4ccc(Cn5cccn5)cc4)nc3n2n1 |
| InChI | InChI=1S/C26H20N6/c1-18-14-24-27-16-22-15-23(20-6-3-2-4-7-20)25(29-26(22)32(24)30-18)21-10-8-19(9-11-21)17-31-13-5-12-28-31/h2-16H,17H2,1H3 |
| InChIKey | GWNOCJKINSTVGE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |