C8H10FN5O3S — CID 66629484
N-[3-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide (PubChem CID 66629484) has the molecular formula C8H10FN5O3S and a molecular weight of 275.26 g/mol. Its IUPAC name is N-[3-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide.
| Compound Name | N-[3-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide |
|---|---|
| PubChem CID | 66629484 |
| Molecular Formula | C8H10FN5O3S |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | N-[3-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide |
| SMILES | CN1COCN(Cc2cnc(F)s2)C1=N[N+](=O)[O-] |
| InChI | InChI=1S/C8H10FN5O3S/c1-12-4-17-5-13(8(12)11-14(15)16)3-6-2-10-7(9)18-6/h2H,3-5H2,1H3 |
| InChIKey | ZJJOMXXMONTXEH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 84.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|