C8H11I2N5O3S — CID 66629538
N-[3-[(2,5-diiodo-2H-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide (PubChem CID 66629538) has the molecular formula C8H11I2N5O3S and a molecular weight of 511.08 g/mol. Its IUPAC name is N-[3-[(2,5-diiodo-2H-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide.
| Compound Name | N-[3-[(2,5-diiodo-2H-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide |
|---|---|
| PubChem CID | 66629538 |
| Molecular Formula | C8H11I2N5O3S |
| Molecular Weight | 511.08 g/mol |
| Exact Mass | 510.87 |
| IUPAC Name | N-[3-[(2,5-diiodo-2H-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide |
| SMILES | CN1COCN(CC2(I)C=NC(I)S2)C1=N[N+](=O)[O-] |
| InChI | InChI=1S/C8H11I2N5O3S/c1-13-4-18-5-14(7(13)12-15(16)17)3-8(10)2-11-6(9)19-8/h2,6H,3-5H2,1H3 |
| InChIKey | FNIXHLLNAVUUCT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 83.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.08 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|