C23H24IN3O5 — CID 66629643
N-[2-(dimethylamino)ethyl]-N-([1,3]dioxolo[4,5-g]quinolin-8-yl)-2-iodo-4,5-dimethoxybenzamide (PubChem CID 66629643) has the molecular formula C23H24IN3O5 and a molecular weight of 549.37 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-([1,3]dioxolo[4,5-g]quinolin-8-yl)-2-iodo-4,5-dimethoxybenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-([1,3]dioxolo[4,5-g]quinolin-8-yl)-2-iodo-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 66629643 |
| Molecular Formula | C23H24IN3O5 |
| Molecular Weight | 549.37 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-([1,3]dioxolo[4,5-g]quinolin-8-yl)-2-iodo-4,5-dimethoxybenzamide |
| SMILES | COc1cc(I)c(C(=O)N(CCN(C)C)c2ccnc3cc4c(cc23)OCO4)cc1OC |
| InChI | InChI=1S/C23H24IN3O5/c1-26(2)7-8-27(23(28)14-9-19(29-3)20(30-4)11-16(14)24)18-5-6-25-17-12-22-21(10-15(17)18)31-13-32-22/h5-6,9-12H,7-8,13H2,1-4H3 |
| InChIKey | AIMWAWAXKVSJJX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|