C14H19NO2 — CID 66630060
(3aS,9bS)-3-ethyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-6,7-diol (PubChem CID 66630060) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (3aS,9bS)-3-ethyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-6,7-diol.
| Compound Name | (3aS,9bS)-3-ethyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-6,7-diol |
|---|---|
| PubChem CID | 66630060 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (3aS,9bS)-3-ethyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-6,7-diol |
| SMILES | CCN1CC[C@H]2c3ccc(O)c(O)c3CC[C@@H]21 |
| InChI | InChI=1S/C14H19NO2/c1-2-15-8-7-10-9-4-6-13(16)14(17)11(9)3-5-12(10)15/h4,6,10,12,16-17H,2-3,5,7-8H2,1H3/t10-,12-/m0/s1 |
| InChIKey | NPCOGWCWUQCSDS-JQWIXIFHSA-N |
| XLogP | 2.22 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|