C45H46F4N8 — CID 66630398
1'-[4-[(2R,5R)-2,5-bis[6-fluoro-2-[(2S)-pyrrolidin-2-yl]-3H-benzimidazol-5-yl]pyrrolidin-1-yl]-2,6-difluorophenyl]spiro[1,2-dihydroindene-3,4'-piperidine] (PubChem CID 66630398) has the molecular formula C45H46F4N8 and a molecular weight of 774.91 g/mol. Its IUPAC name is 1'-[4-[(2R,5R)-2,5-bis[6-fluoro-2-[(2S)-pyrrolidin-2-yl]-3H-benzimidazol-5-yl]pyrrolidin-1-yl]-2,6-difluorophenyl]spiro[1,2-dihydroindene-3,4'-piperidine].
| Compound Name | 1'-[4-[(2R,5R)-2,5-bis[6-fluoro-2-[(2S)-pyrrolidin-2-yl]-3H-benzimidazol-5-yl]pyrrolidin-1-yl]-2,6-difluorophenyl]spiro[1,2-dihydroindene-3,4'-piperidine] |
|---|---|
| PubChem CID | 66630398 |
| Molecular Formula | C45H46F4N8 |
| Molecular Weight | 774.91 g/mol |
| Exact Mass | 774.38 |
| IUPAC Name | 1'-[4-[(2R,5R)-2,5-bis[6-fluoro-2-[(2S)-pyrrolidin-2-yl]-3H-benzimidazol-5-yl]pyrrolidin-1-yl]-2,6-difluorophenyl]spiro[1,2-dihydroindene-3,4'-piperidine] |
| SMILES | Fc1cc2nc([C@@H]3CCCN3)[nH]c2cc1[C@H]1CC[C@H](c2cc3[nH]c([C@@H]4CCCN4)nc3cc2F)N1c1cc(F)c(N2CCC3(CCc4ccccc43)CC2)c(F)c1 |
| InChI | InChI=1S/C45H46F4N8/c46-30-23-38-36(52-43(54-38)34-7-3-15-50-34)21-27(30)40-9-10-41(28-22-37-39(24-31(28)47)55-44(53-37)35-8-4-16-51-35)57(40)26-19-32(48)42(33(49)20-26)56-17-13-45(14-18-56)12-11-25-5-1-2-6-29(25)45/h1-2,5-6,19-24,34-35,40-41,50-51H,3-4,7-18H2,(H,52,54)(H,53,55)/t34-,35-,40+,41+/m0/s1 |
| InChIKey | PVWVNFWBJMSFKI-GLUIXYTFSA-N |
| XLogP | 9.41 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.91 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|