C26H38N2O5S — CID 66630522
4-[ethylsulfonyl(piperidin-4-yl)methoxy]-N-(5-hydroxy-2-adamantyl)-N-methylbenzamide (PubChem CID 66630522) has the molecular formula C26H38N2O5S and a molecular weight of 490.67 g/mol. Its IUPAC name is 4-[ethylsulfonyl(piperidin-4-yl)methoxy]-N-(5-hydroxy-2-adamantyl)-N-methylbenzamide.
| Compound Name | 4-[ethylsulfonyl(piperidin-4-yl)methoxy]-N-(5-hydroxy-2-adamantyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 66630522 |
| Molecular Formula | C26H38N2O5S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 4-[ethylsulfonyl(piperidin-4-yl)methoxy]-N-(5-hydroxy-2-adamantyl)-N-methylbenzamide |
| SMILES | CCS(=O)(=O)C(Oc1ccc(C(=O)N(C)C2C3CC4CC2CC(O)(C4)C3)cc1)C1CCNCC1 |
| InChI | InChI=1S/C26H38N2O5S/c1-3-34(31,32)25(19-8-10-27-11-9-19)33-22-6-4-18(5-7-22)24(29)28(2)23-20-12-17-13-21(23)16-26(30,14-17)15-20/h4-7,17,19-21,23,25,27,30H,3,8-16H2,1-2H3 |
| InChIKey | RMIPOZOMLCXBHU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |