C36H38N2O4S — CID 66631451
[1-butoxy-2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-thiophen-2-ylquinolin-6-yl]ethyl] 2,2-dimethylpropanoate (PubChem CID 66631451) has the molecular formula C36H38N2O4S and a molecular weight of 594.78 g/mol. Its IUPAC name is [1-butoxy-2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-thiophen-2-ylquinolin-6-yl]ethyl] 2,2-dimethylpropanoate.
| Compound Name | [1-butoxy-2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-thiophen-2-ylquinolin-6-yl]ethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 66631451 |
| Molecular Formula | C36H38N2O4S |
| Molecular Weight | 594.78 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | [1-butoxy-2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-thiophen-2-ylquinolin-6-yl]ethyl] 2,2-dimethylpropanoate |
| SMILES | CCCCOC(Cc1c(C)cc2nc(-c3cccs3)ccc2c1-c1ccc2c3c(ccnc13)CCO2)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C36H38N2O4S/c1-6-7-17-41-31(42-35(39)36(3,4)5)21-26-22(2)20-28-24(10-12-27(38-28)30-9-8-19-43-30)33(26)25-11-13-29-32-23(15-18-40-29)14-16-37-34(25)32/h8-14,16,19-20,31H,6-7,15,17-18,21H2,1-5H3 |
| InChIKey | DUMFXRLVCWCATC-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.78 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|