About ethyl (2S)-2-(5-bromo-2,7-dimethyl-1-oxidoquinolin-1-ium-6-yl)-2-[(2-methylpropan-2-yl)oxy]acetate
ethyl (2S)-2-(5-bromo-2,7-dimethyl-1-oxidoquinolin-1-ium-6-yl)-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 66631477) has the molecular formula C19H24BrNO4
and a molecular weight of 410.31 g/mol. Its IUPAC name is ethyl (2S)-2-(5-bromo-2,7-dimethyl-1-oxidoquinolin-1-ium-6-yl)-2-[(2-methylpropan-2-yl)oxy]acetate.
Molecular Properties
| Compound Name | ethyl (2S)-2-(5-bromo-2,7-dimethyl-1-oxidoquinolin-1-ium-6-yl)-2-[(2-methylpropan-2-yl)oxy]acetate |
| PubChem CID | 66631477 |
| Molecular Formula | C19H24BrNO4 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | ethyl (2S)-2-(5-bromo-2,7-dimethyl-1-oxidoquinolin-1-ium-6-yl)-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | CCOC(=O)[C@@H](OC(C)(C)C)c1c(C)cc2c(ccc(C)[n+]2[O-])c1Br |
| InChI | InChI=1S/C19H24BrNO4/c1-7-24-18(22)17(25-19(4,5)6)15-11(2)10-14-13(16(15)20)9-8-12(3)21(14)23/h8-10,17H,7H2,1-6H3/t17-/m0/s1 |
| InChIKey | YSMVOFNHWPFENE-KRWDZBQOSA-N |
| XLogP | 4.27 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S)-2-(5-bromo-2,7-dimethyl-1-oxidoquinolin-1-ium-6-yl)-2-[(2-methylpropan-2-yl)oxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-(5-bromo-2,7-dimethyl-1-oxidoquinolin-1-ium-6-yl)-2-[(2-methylpropan-2-yl)oxy]acetate?
The IUPAC name of ethyl (2S)-2-(5-bromo-2,7-dimethyl-1-oxidoquinolin-1-ium-6-yl)-2-[(2-methylpropan-2-yl)oxy]acetate (CID 66631477) is ethyl (2S)-2-(5-bromo-2,7-dimethyl-1-oxidoquinolin-1-ium-6-yl)-2-[(2-methylpropan-2-yl)oxy]acetate.
What is the SMILES notation for ethyl (2S)-2-(5-bromo-2,7-dimethyl-1-oxidoquinolin-1-ium-6-yl)-2-[(2-methylpropan-2-yl)oxy]acetate?
The canonical SMILES for ethyl (2S)-2-(5-bromo-2,7-dimethyl-1-oxidoquinolin-1-ium-6-yl)-2-[(2-methylpropan-2-yl)oxy]acetate is CCOC(=O)[C@@H](OC(C)(C)C)c1c(C)cc2c(ccc(C)[n+]2[O-])c1Br.
What is the InChIKey of ethyl (2S)-2-(5-bromo-2,7-dimethyl-1-oxidoquinolin-1-ium-6-yl)-2-[(2-methylpropan-2-yl)oxy]acetate?
The InChIKey is YSMVOFNHWPFENE-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H24BrNO4/c1-7-24-18(22)17(25-19(4,5)6)15-11(2)10-14-13(16(15)20)9-8-12(3)21(14)23/h8-10,17H,7H2,1-6H3/t17-/m0/s1.
What are the key properties of ethyl (2S)-2-(5-bromo-2,7-dimethyl-1-oxidoquinolin-1-ium-6-yl)-2-[(2-methylpropan-2-yl)oxy]acetate?
ethyl (2S)-2-(5-bromo-2,7-dimethyl-1-oxidoquinolin-1-ium-6-yl)-2-[(2-methylpropan-2-yl)oxy]acetate has a molecular weight of 410.31 g/mol, XLogP of 4.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-(5-bromo-2,7-dimethyl-1-oxidoquinolin-1-ium-6-yl)-2-[(2-methylpropan-2-yl)oxy]acetate is sourced from PubChem (CID 66631477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).