C31H28N2O4S — CID 66631521
2-butoxy-2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-thiophen-2-ylquinolin-6-yl]acetic acid (PubChem CID 66631521) has the molecular formula C31H28N2O4S and a molecular weight of 524.64 g/mol. Its IUPAC name is 2-butoxy-2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-thiophen-2-ylquinolin-6-yl]acetic acid.
| Compound Name | 2-butoxy-2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-thiophen-2-ylquinolin-6-yl]acetic acid |
|---|---|
| PubChem CID | 66631521 |
| Molecular Formula | C31H28N2O4S |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 2-butoxy-2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-thiophen-2-ylquinolin-6-yl]acetic acid |
| SMILES | CCCCOC(C(=O)O)c1c(C)cc2nc(-c3cccs3)ccc2c1-c1ccc2c3c(ccnc13)CCO2 |
| InChI | InChI=1S/C31H28N2O4S/c1-3-4-14-37-30(31(34)35)26-18(2)17-23-20(7-9-22(33-23)25-6-5-16-38-25)28(26)21-8-10-24-27-19(12-15-36-24)11-13-32-29(21)27/h5-11,13,16-17,30H,3-4,12,14-15H2,1-2H3,(H,34,35) |
| InChIKey | CQHYFOTUGLMIGJ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|