C28H28N2O5 — CID 66631856
2-butoxy-2-[2-(hydroxymethyl)-7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-6-yl]acetic acid (PubChem CID 66631856) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is 2-butoxy-2-[2-(hydroxymethyl)-7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-6-yl]acetic acid.
| Compound Name | 2-butoxy-2-[2-(hydroxymethyl)-7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-6-yl]acetic acid |
|---|---|
| PubChem CID | 66631856 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 2-butoxy-2-[2-(hydroxymethyl)-7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-6-yl]acetic acid |
| SMILES | CCCCOC(C(=O)O)c1c(C)cc2nc(CO)ccc2c1-c1ccc2c3c(ccnc13)CCO2 |
| InChI | InChI=1S/C28H28N2O5/c1-3-4-12-35-27(28(32)33)23-16(2)14-21-19(6-5-18(15-31)30-21)25(23)20-7-8-22-24-17(10-13-34-22)9-11-29-26(20)24/h5-9,11,14,27,31H,3-4,10,12-13,15H2,1-2H3,(H,32,33) |
| InChIKey | QULHPZVQPJXULR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|