C16H26O2 — CID 66632011
2-[(2,6,6-trimethylcyclohex-2-en-1-yl)methylidene]hexanoic acid (PubChem CID 66632011) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-[(2,6,6-trimethylcyclohex-2-en-1-yl)methylidene]hexanoic acid.
| Compound Name | 2-[(2,6,6-trimethylcyclohex-2-en-1-yl)methylidene]hexanoic acid |
|---|---|
| PubChem CID | 66632011 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2-[(2,6,6-trimethylcyclohex-2-en-1-yl)methylidene]hexanoic acid |
| SMILES | CCCCC(=CC1C(C)=CCCC1(C)C)C(=O)O |
| InChI | InChI=1S/C16H26O2/c1-5-6-9-13(15(17)18)11-14-12(2)8-7-10-16(14,3)4/h8,11,14H,5-7,9-10H2,1-4H3,(H,17,18) |
| InChIKey | WNXQOZVKERZTKK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|