C17H27N3O10 — CID 66632028
bis(2-methylprop-2-enoic acid);1,3,5-tris(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 66632028) has the molecular formula C17H27N3O10 and a molecular weight of 433.41 g/mol. Its IUPAC name is bis(2-methylprop-2-enoic acid);1,3,5-tris(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | bis(2-methylprop-2-enoic acid);1,3,5-tris(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 66632028 |
| Molecular Formula | C17H27N3O10 |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | bis(2-methylprop-2-enoic acid);1,3,5-tris(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.O=c1n(CCO)c(=O)n(CCO)c(=O)n1CCO |
| InChI | InChI=1S/C9H15N3O6.2C4H6O2/c13-4-1-10-7(16)11(2-5-14)9(18)12(3-6-15)8(10)17;2*1-3(2)4(5)6/h13-15H,1-6H2;2*1H2,2H3,(H,5,6) |
| InChIKey | TVEXICCMHMNGFJ-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 201.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|