C28H27F3N2O3 — CID 66632091
1-butoxy-2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-(trifluoromethyl)quinolin-6-yl]ethanol (PubChem CID 66632091) has the molecular formula C28H27F3N2O3 and a molecular weight of 496.53 g/mol. Its IUPAC name is 1-butoxy-2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-(trifluoromethyl)quinolin-6-yl]ethanol.
| Compound Name | 1-butoxy-2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-(trifluoromethyl)quinolin-6-yl]ethanol |
|---|---|
| PubChem CID | 66632091 |
| Molecular Formula | C28H27F3N2O3 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 1-butoxy-2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-(trifluoromethyl)quinolin-6-yl]ethanol |
| SMILES | CCCCOC(O)Cc1c(C)cc2nc(C(F)(F)F)ccc2c1-c1ccc2c3c(ccnc13)CCO2 |
| InChI | InChI=1S/C28H27F3N2O3/c1-3-4-12-36-24(34)15-20-16(2)14-21-18(6-8-23(33-21)28(29,30)31)26(20)19-5-7-22-25-17(10-13-35-22)9-11-32-27(19)25/h5-9,11,14,24,34H,3-4,10,12-13,15H2,1-2H3 |
| InChIKey | QGCVOMKHJOECKI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|