About 2-[2-(2,6-dichloroanilino)phenyl]-4-(2-methyl-5-nitroimidazol-1-yl)butanoic acid;hydrochloride
2-[2-(2,6-dichloroanilino)phenyl]-4-(2-methyl-5-nitroimidazol-1-yl)butanoic acid;hydrochloride (PubChem CID 66632259) has the molecular formula C20H19Cl3N4O4
and a molecular weight of 485.76 g/mol. Its IUPAC name is 2-[2-(2,6-dichloroanilino)phenyl]-4-(2-methyl-5-nitroimidazol-1-yl)butanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-[2-(2,6-dichloroanilino)phenyl]-4-(2-methyl-5-nitroimidazol-1-yl)butanoic acid;hydrochloride |
| PubChem CID | 66632259 |
| Molecular Formula | C20H19Cl3N4O4 |
| Molecular Weight | 485.76 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 2-[2-(2,6-dichloroanilino)phenyl]-4-(2-methyl-5-nitroimidazol-1-yl)butanoic acid;hydrochloride |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCC(C(=O)O)c1ccccc1Nc1c(Cl)cccc1Cl.Cl |
| InChI | InChI=1S/C20H18Cl2N4O4.ClH/c1-12-23-11-18(26(29)30)25(12)10-9-14(20(27)28)13-5-2-3-8-17(13)24-19-15(21)6-4-7-16(19)22;/h2-8,11,14,24H,9-10H2,1H3,(H,27,28);1H |
| InChIKey | BPKJEPAGYMIVML-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.76 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,6-dichloroanilino)phenyl]-4-(2-methyl-5-nitroimidazol-1-yl)butanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,6-dichloroanilino)phenyl]-4-(2-methyl-5-nitroimidazol-1-yl)butanoic acid;hydrochloride?
The IUPAC name of 2-[2-(2,6-dichloroanilino)phenyl]-4-(2-methyl-5-nitroimidazol-1-yl)butanoic acid;hydrochloride (CID 66632259) is 2-[2-(2,6-dichloroanilino)phenyl]-4-(2-methyl-5-nitroimidazol-1-yl)butanoic acid;hydrochloride.
What is the SMILES notation for 2-[2-(2,6-dichloroanilino)phenyl]-4-(2-methyl-5-nitroimidazol-1-yl)butanoic acid;hydrochloride?
The canonical SMILES for 2-[2-(2,6-dichloroanilino)phenyl]-4-(2-methyl-5-nitroimidazol-1-yl)butanoic acid;hydrochloride is Cc1ncc([N+](=O)[O-])n1CCC(C(=O)O)c1ccccc1Nc1c(Cl)cccc1Cl.Cl.
What is the InChIKey of 2-[2-(2,6-dichloroanilino)phenyl]-4-(2-methyl-5-nitroimidazol-1-yl)butanoic acid;hydrochloride?
The InChIKey is BPKJEPAGYMIVML-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18Cl2N4O4.ClH/c1-12-23-11-18(26(29)30)25(12)10-9-14(20(27)28)13-5-2-3-8-17(13)24-19-15(21)6-4-7-16(19)22;/h2-8,11,14,24H,9-10H2,1H3,(H,27,28);1H.
What are the key properties of 2-[2-(2,6-dichloroanilino)phenyl]-4-(2-methyl-5-nitroimidazol-1-yl)butanoic acid;hydrochloride?
2-[2-(2,6-dichloroanilino)phenyl]-4-(2-methyl-5-nitroimidazol-1-yl)butanoic acid;hydrochloride has a molecular weight of 485.76 g/mol, XLogP of 5.83, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,6-dichloroanilino)phenyl]-4-(2-methyl-5-nitroimidazol-1-yl)butanoic acid;hydrochloride is sourced from PubChem (CID 66632259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).