About (2-aminophenyl) N-tert-butylcarbamate
(2-aminophenyl) N-tert-butylcarbamate (PubChem CID 66632468) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is (2-aminophenyl) N-tert-butylcarbamate.
Molecular Properties
| Compound Name | (2-aminophenyl) N-tert-butylcarbamate |
| PubChem CID | 66632468 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (2-aminophenyl) N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)Oc1ccccc1N |
| InChI | InChI=1S/C11H16N2O2/c1-11(2,3)13-10(14)15-9-7-5-4-6-8(9)12/h4-7H,12H2,1-3H3,(H,13,14) |
| InChIKey | QLRRLKCBUCIJIX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-aminophenyl) N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminophenyl) N-tert-butylcarbamate?
The IUPAC name of (2-aminophenyl) N-tert-butylcarbamate (CID 66632468) is (2-aminophenyl) N-tert-butylcarbamate.
What is the SMILES notation for (2-aminophenyl) N-tert-butylcarbamate?
The canonical SMILES for (2-aminophenyl) N-tert-butylcarbamate is CC(C)(C)NC(=O)Oc1ccccc1N.
What is the InChIKey of (2-aminophenyl) N-tert-butylcarbamate?
The InChIKey is QLRRLKCBUCIJIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-11(2,3)13-10(14)15-9-7-5-4-6-8(9)12/h4-7H,12H2,1-3H3,(H,13,14).
What are the key properties of (2-aminophenyl) N-tert-butylcarbamate?
(2-aminophenyl) N-tert-butylcarbamate has a molecular weight of 208.26 g/mol, XLogP of 2.16, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminophenyl) N-tert-butylcarbamate is sourced from PubChem (CID 66632468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).