About (1-methylpyrazol-4-yl) hydrogen carbonate
(1-methylpyrazol-4-yl) hydrogen carbonate (PubChem CID 66632502) has the molecular formula C5H6N2O3
and a molecular weight of 142.11 g/mol. Its IUPAC name is (1-methylpyrazol-4-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (1-methylpyrazol-4-yl) hydrogen carbonate |
| PubChem CID | 66632502 |
| Molecular Formula | C5H6N2O3 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | (1-methylpyrazol-4-yl) hydrogen carbonate |
| SMILES | Cn1cc(OC(=O)O)cn1 |
| InChI | InChI=1S/C5H6N2O3/c1-7-3-4(2-6-7)10-5(8)9/h2-3H,1H3,(H,8,9) |
| InChIKey | DEJASHLEAJOEOB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methylpyrazol-4-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpyrazol-4-yl) hydrogen carbonate?
The IUPAC name of (1-methylpyrazol-4-yl) hydrogen carbonate (CID 66632502) is (1-methylpyrazol-4-yl) hydrogen carbonate.
What is the SMILES notation for (1-methylpyrazol-4-yl) hydrogen carbonate?
The canonical SMILES for (1-methylpyrazol-4-yl) hydrogen carbonate is Cn1cc(OC(=O)O)cn1.
What is the InChIKey of (1-methylpyrazol-4-yl) hydrogen carbonate?
The InChIKey is DEJASHLEAJOEOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3/c1-7-3-4(2-6-7)10-5(8)9/h2-3H,1H3,(H,8,9).
What are the key properties of (1-methylpyrazol-4-yl) hydrogen carbonate?
(1-methylpyrazol-4-yl) hydrogen carbonate has a molecular weight of 142.11 g/mol, XLogP of 0.48, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpyrazol-4-yl) hydrogen carbonate is sourced from PubChem (CID 66632502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).