C9H9F3O3 — CID 66633105
anisole;2,2,2-trifluoroacetic acid (PubChem CID 66633105) has the molecular formula C9H9F3O3 and a molecular weight of 222.16 g/mol. Its IUPAC name is anisole;2,2,2-trifluoroacetic acid.
| Compound Name | anisole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66633105 |
| Molecular Formula | C9H9F3O3 |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | anisole;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H8O.C2HF3O2/c1-8-7-5-3-2-4-6-7;3-2(4,5)1(6)7/h2-6H,1H3;(H,6,7) |
| InChIKey | NVYVHAPFRUEAJN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |