About 1,2-dipentyl-2H-pyrimidine
1,2-dipentyl-2H-pyrimidine (PubChem CID 66633153) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is 1,2-dipentyl-2H-pyrimidine.
Molecular Properties
| Compound Name | 1,2-dipentyl-2H-pyrimidine |
| PubChem CID | 66633153 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 1,2-dipentyl-2H-pyrimidine |
| SMILES | CCCCCC1N=CC=CN1CCCCC |
| InChI | InChI=1S/C14H26N2/c1-3-5-7-10-14-15-11-9-13-16(14)12-8-6-4-2/h9,11,13-14H,3-8,10,12H2,1-2H3 |
| InChIKey | LGSZSEITQMZIHS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dipentyl-2H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dipentyl-2H-pyrimidine?
The IUPAC name of 1,2-dipentyl-2H-pyrimidine (CID 66633153) is 1,2-dipentyl-2H-pyrimidine.
What is the SMILES notation for 1,2-dipentyl-2H-pyrimidine?
The canonical SMILES for 1,2-dipentyl-2H-pyrimidine is CCCCCC1N=CC=CN1CCCCC.
What is the InChIKey of 1,2-dipentyl-2H-pyrimidine?
The InChIKey is LGSZSEITQMZIHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2/c1-3-5-7-10-14-15-11-9-13-16(14)12-8-6-4-2/h9,11,13-14H,3-8,10,12H2,1-2H3.
What are the key properties of 1,2-dipentyl-2H-pyrimidine?
1,2-dipentyl-2H-pyrimidine has a molecular weight of 222.38 g/mol, XLogP of 3.98, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dipentyl-2H-pyrimidine is sourced from PubChem (CID 66633153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).