About N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)prop-2-enamide
N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)prop-2-enamide (PubChem CID 66633193) has the molecular formula C14H20N2O2
and a molecular weight of 248.33 g/mol. Its IUPAC name is N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)prop-2-enamide.
Molecular Properties
| Compound Name | N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)prop-2-enamide |
| PubChem CID | 66633193 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(C)c(C)n(CCCC)c1=O |
| InChI | InChI=1S/C14H20N2O2/c1-5-7-8-16-11(4)10(3)9-12(14(16)18)15-13(17)6-2/h6,9H,2,5,7-8H2,1,3-4H3,(H,15,17) |
| InChIKey | OTJDOFWFTPRVEF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)prop-2-enamide?
The IUPAC name of N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)prop-2-enamide (CID 66633193) is N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)prop-2-enamide.
What is the SMILES notation for N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)prop-2-enamide?
The canonical SMILES for N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)prop-2-enamide is C=CC(=O)Nc1cc(C)c(C)n(CCCC)c1=O.
What is the InChIKey of N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)prop-2-enamide?
The InChIKey is OTJDOFWFTPRVEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c1-5-7-8-16-11(4)10(3)9-12(14(16)18)15-13(17)6-2/h6,9H,2,5,7-8H2,1,3-4H3,(H,15,17).
What are the key properties of N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)prop-2-enamide?
N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)prop-2-enamide has a molecular weight of 248.33 g/mol, XLogP of 2.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)prop-2-enamide is sourced from PubChem (CID 66633193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).