About 3,6-dipentyl-1,6-dihydropyrimidin-2-one
3,6-dipentyl-1,6-dihydropyrimidin-2-one (PubChem CID 66633362) has the molecular formula C14H26N2O
and a molecular weight of 238.37 g/mol. Its IUPAC name is 3,6-dipentyl-1,6-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 3,6-dipentyl-1,6-dihydropyrimidin-2-one |
| PubChem CID | 66633362 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 3,6-dipentyl-1,6-dihydropyrimidin-2-one |
| SMILES | CCCCCC1C=CN(CCCCC)C(=O)N1 |
| InChI | InChI=1S/C14H26N2O/c1-3-5-7-9-13-10-12-16(14(17)15-13)11-8-6-4-2/h10,12-13H,3-9,11H2,1-2H3,(H,15,17) |
| InChIKey | MNVYYEJEPFQVMD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dipentyl-1,6-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dipentyl-1,6-dihydropyrimidin-2-one?
The IUPAC name of 3,6-dipentyl-1,6-dihydropyrimidin-2-one (CID 66633362) is 3,6-dipentyl-1,6-dihydropyrimidin-2-one.
What is the SMILES notation for 3,6-dipentyl-1,6-dihydropyrimidin-2-one?
The canonical SMILES for 3,6-dipentyl-1,6-dihydropyrimidin-2-one is CCCCCC1C=CN(CCCCC)C(=O)N1.
What is the InChIKey of 3,6-dipentyl-1,6-dihydropyrimidin-2-one?
The InChIKey is MNVYYEJEPFQVMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O/c1-3-5-7-9-13-10-12-16(14(17)15-13)11-8-6-4-2/h10,12-13H,3-9,11H2,1-2H3,(H,15,17).
What are the key properties of 3,6-dipentyl-1,6-dihydropyrimidin-2-one?
3,6-dipentyl-1,6-dihydropyrimidin-2-one has a molecular weight of 238.37 g/mol, XLogP of 3.66, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dipentyl-1,6-dihydropyrimidin-2-one is sourced from PubChem (CID 66633362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).