C26H26NO5S- — CID 66633469
5-(carboxymethoxy)-1-[3-methyl-4-(4-methylphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene (PubChem CID 66633469) has the molecular formula C26H26NO5S- and a molecular weight of 464.56 g/mol. Its IUPAC name is 5-(carboxymethoxy)-1-[3-methyl-4-(4-methylphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-(carboxymethoxy)-1-[3-methyl-4-(4-methylphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 66633469 |
| Molecular Formula | C26H26NO5S- |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 5-(carboxymethoxy)-1-[3-methyl-4-(4-methylphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1ccc(-c2ccc(N(C3CCCc4c(OCC(=O)O)cccc43)S(=O)[O-])cc2C)cc1 |
| InChI | InChI=1S/C26H27NO5S/c1-17-9-11-19(12-10-17)21-14-13-20(15-18(21)2)27(33(30)31)24-7-3-6-23-22(24)5-4-8-25(23)32-16-26(28)29/h4-5,8-15,24H,3,6-7,16H2,1-2H3,(H,28,29)(H,30,31)/p-1 |
| InChIKey | IBWAKIFYWLMELK-UHFFFAOYSA-M |
| XLogP | 5.11 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|