C25H23FNO6S- — CID 66633523
5-(carboxymethoxy)-1-[4-(3-fluoro-5-methoxyphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene (PubChem CID 66633523) has the molecular formula C25H23FNO6S- and a molecular weight of 484.53 g/mol. Its IUPAC name is 5-(carboxymethoxy)-1-[4-(3-fluoro-5-methoxyphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-(carboxymethoxy)-1-[4-(3-fluoro-5-methoxyphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 66633523 |
| Molecular Formula | C25H23FNO6S- |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 5-(carboxymethoxy)-1-[4-(3-fluoro-5-methoxyphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1cc(F)cc(-c2ccc(N(C3CCCc4c(OCC(=O)O)cccc43)S(=O)[O-])cc2)c1 |
| InChI | InChI=1S/C25H24FNO6S/c1-32-20-13-17(12-18(26)14-20)16-8-10-19(11-9-16)27(34(30)31)23-6-2-5-22-21(23)4-3-7-24(22)33-15-25(28)29/h3-4,7-14,23H,2,5-6,15H2,1H3,(H,28,29)(H,30,31)/p-1 |
| InChIKey | JHGBMVUIHHYZFP-UHFFFAOYSA-M |
| XLogP | 4.64 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|