C13H26N2 — CID 66633669
1,3-dipentyl-2H-imidazole (PubChem CID 66633669) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 1,3-dipentyl-2H-imidazole.
| Compound Name | 1,3-dipentyl-2H-imidazole |
|---|---|
| PubChem CID | 66633669 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 1,3-dipentyl-2H-imidazole |
| SMILES | CCCCCN1C=CN(CCCCC)C1 |
| InChI | InChI=1S/C13H26N2/c1-3-5-7-9-14-11-12-15(13-14)10-8-6-4-2/h11-12H,3-10,13H2,1-2H3 |
| InChIKey | MAVQFWGWHANVTG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|