C11H21N3 — CID 66633673
6-butyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine (PubChem CID 66633673) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 6-butyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine.
| Compound Name | 6-butyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 66633673 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 6-butyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine |
| SMILES | CCCCC1CCNC2=NCCCN21 |
| InChI | InChI=1S/C11H21N3/c1-2-3-5-10-6-8-13-11-12-7-4-9-14(10)11/h10H,2-9H2,1H3,(H,12,13) |
| InChIKey | NYVBDLBAQKTIKW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |