About (6-tert-butyl-3-pyridinyl)methyl 2-methyl-1,8-naphthyridine-3-carboxylate
(6-tert-butyl-3-pyridinyl)methyl 2-methyl-1,8-naphthyridine-3-carboxylate (PubChem CID 66633722) has the molecular formula C20H21N3O2
and a molecular weight of 335.41 g/mol. Its IUPAC name is (6-tert-butyl-3-pyridinyl)methyl 2-methyl-1,8-naphthyridine-3-carboxylate.
Molecular Properties
| Compound Name | (6-tert-butyl-3-pyridinyl)methyl 2-methyl-1,8-naphthyridine-3-carboxylate |
| PubChem CID | 66633722 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (6-tert-butyl-3-pyridinyl)methyl 2-methyl-1,8-naphthyridine-3-carboxylate |
| SMILES | Cc1nc2ncccc2cc1C(=O)OCc1ccc(C(C)(C)C)nc1 |
| InChI | InChI=1S/C20H21N3O2/c1-13-16(10-15-6-5-9-21-18(15)23-13)19(24)25-12-14-7-8-17(22-11-14)20(2,3)4/h5-11H,12H2,1-4H3 |
| InChIKey | ZXEDSXHSHPGGAK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6-tert-butyl-3-pyridinyl)methyl 2-methyl-1,8-naphthyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-tert-butyl-3-pyridinyl)methyl 2-methyl-1,8-naphthyridine-3-carboxylate?
The IUPAC name of (6-tert-butyl-3-pyridinyl)methyl 2-methyl-1,8-naphthyridine-3-carboxylate (CID 66633722) is (6-tert-butyl-3-pyridinyl)methyl 2-methyl-1,8-naphthyridine-3-carboxylate.
What is the SMILES notation for (6-tert-butyl-3-pyridinyl)methyl 2-methyl-1,8-naphthyridine-3-carboxylate?
The canonical SMILES for (6-tert-butyl-3-pyridinyl)methyl 2-methyl-1,8-naphthyridine-3-carboxylate is Cc1nc2ncccc2cc1C(=O)OCc1ccc(C(C)(C)C)nc1.
What is the InChIKey of (6-tert-butyl-3-pyridinyl)methyl 2-methyl-1,8-naphthyridine-3-carboxylate?
The InChIKey is ZXEDSXHSHPGGAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O2/c1-13-16(10-15-6-5-9-21-18(15)23-13)19(24)25-12-14-7-8-17(22-11-14)20(2,3)4/h5-11H,12H2,1-4H3.
What are the key properties of (6-tert-butyl-3-pyridinyl)methyl 2-methyl-1,8-naphthyridine-3-carboxylate?
(6-tert-butyl-3-pyridinyl)methyl 2-methyl-1,8-naphthyridine-3-carboxylate has a molecular weight of 335.41 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-tert-butyl-3-pyridinyl)methyl 2-methyl-1,8-naphthyridine-3-carboxylate is sourced from PubChem (CID 66633722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).