About 2-(3-cyclopenta-2,4-dien-1-ylidenebutyl)-1,3-dioxane
2-(3-cyclopenta-2,4-dien-1-ylidenebutyl)-1,3-dioxane (PubChem CID 66633731) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(3-cyclopenta-2,4-dien-1-ylidenebutyl)-1,3-dioxane.
Molecular Properties
| Compound Name | 2-(3-cyclopenta-2,4-dien-1-ylidenebutyl)-1,3-dioxane |
| PubChem CID | 66633731 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-(3-cyclopenta-2,4-dien-1-ylidenebutyl)-1,3-dioxane |
| SMILES | CC(CCC1OCCCO1)=C1C=CC=C1 |
| InChI | InChI=1S/C13H18O2/c1-11(12-5-2-3-6-12)7-8-13-14-9-4-10-15-13/h2-3,5-6,13H,4,7-10H2,1H3 |
| InChIKey | QSXPSYRCLJTNBO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-cyclopenta-2,4-dien-1-ylidenebutyl)-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-cyclopenta-2,4-dien-1-ylidenebutyl)-1,3-dioxane?
The IUPAC name of 2-(3-cyclopenta-2,4-dien-1-ylidenebutyl)-1,3-dioxane (CID 66633731) is 2-(3-cyclopenta-2,4-dien-1-ylidenebutyl)-1,3-dioxane.
What is the SMILES notation for 2-(3-cyclopenta-2,4-dien-1-ylidenebutyl)-1,3-dioxane?
The canonical SMILES for 2-(3-cyclopenta-2,4-dien-1-ylidenebutyl)-1,3-dioxane is CC(CCC1OCCCO1)=C1C=CC=C1.
What is the InChIKey of 2-(3-cyclopenta-2,4-dien-1-ylidenebutyl)-1,3-dioxane?
The InChIKey is QSXPSYRCLJTNBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-11(12-5-2-3-6-12)7-8-13-14-9-4-10-15-13/h2-3,5-6,13H,4,7-10H2,1H3.
What are the key properties of 2-(3-cyclopenta-2,4-dien-1-ylidenebutyl)-1,3-dioxane?
2-(3-cyclopenta-2,4-dien-1-ylidenebutyl)-1,3-dioxane has a molecular weight of 206.29 g/mol, XLogP of 2.97, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyclopenta-2,4-dien-1-ylidenebutyl)-1,3-dioxane is sourced from PubChem (CID 66633731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).