C26H46N2Si — CID 66634077
N-[bis(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-(prop-2-enylamino)silyl]prop-2-en-1-amine (PubChem CID 66634077) has the molecular formula C26H46N2Si and a molecular weight of 414.75 g/mol. Its IUPAC name is N-[bis(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-(prop-2-enylamino)silyl]prop-2-en-1-amine.
| Compound Name | N-[bis(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-(prop-2-enylamino)silyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 66634077 |
| Molecular Formula | C26H46N2Si |
| Molecular Weight | 414.75 g/mol |
| Exact Mass | 414.34 |
| IUPAC Name | N-[bis(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-(prop-2-enylamino)silyl]prop-2-en-1-amine |
| SMILES | C=CCN[Si](NCC=C)(C1CCCC2CCCCC21)C1CCCC2CCCCC21 |
| InChI | InChI=1S/C26H46N2Si/c1-3-19-27-29(28-20-4-2,25-17-9-13-21-11-5-7-15-23(21)25)26-18-10-14-22-12-6-8-16-24(22)26/h3-4,21-28H,1-2,5-20H2 |
| InChIKey | JLHIGVHLGLTQPX-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.75 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|