About (1S,4R)-4-[(2S,3S)-3-iodooxolan-2-yl]oxycyclopent-2-en-1-ol
(1S,4R)-4-[(2S,3S)-3-iodooxolan-2-yl]oxycyclopent-2-en-1-ol (PubChem CID 66634577) has the molecular formula C9H13IO3
and a molecular weight of 296.10 g/mol. Its IUPAC name is (1S,4R)-4-[(2S,3S)-3-iodooxolan-2-yl]oxycyclopent-2-en-1-ol.
Molecular Properties
| Compound Name | (1S,4R)-4-[(2S,3S)-3-iodooxolan-2-yl]oxycyclopent-2-en-1-ol |
| PubChem CID | 66634577 |
| Molecular Formula | C9H13IO3 |
| Molecular Weight | 296.10 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | (1S,4R)-4-[(2S,3S)-3-iodooxolan-2-yl]oxycyclopent-2-en-1-ol |
| SMILES | O[C@@H]1C=C[C@H](O[C@@H]2OCC[C@@H]2I)C1 |
| InChI | InChI=1S/C9H13IO3/c10-8-3-4-12-9(8)13-7-2-1-6(11)5-7/h1-2,6-9,11H,3-5H2/t6-,7+,8+,9+/m1/s1 |
| InChIKey | JRSACPLAGJWACT-XGEHTFHBSA-N |
| XLogP | 1.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.10 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,4R)-4-[(2S,3S)-3-iodooxolan-2-yl]oxycyclopent-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4R)-4-[(2S,3S)-3-iodooxolan-2-yl]oxycyclopent-2-en-1-ol?
The IUPAC name of (1S,4R)-4-[(2S,3S)-3-iodooxolan-2-yl]oxycyclopent-2-en-1-ol (CID 66634577) is (1S,4R)-4-[(2S,3S)-3-iodooxolan-2-yl]oxycyclopent-2-en-1-ol.
What is the SMILES notation for (1S,4R)-4-[(2S,3S)-3-iodooxolan-2-yl]oxycyclopent-2-en-1-ol?
The canonical SMILES for (1S,4R)-4-[(2S,3S)-3-iodooxolan-2-yl]oxycyclopent-2-en-1-ol is O[C@@H]1C=C[C@H](O[C@@H]2OCC[C@@H]2I)C1.
What is the InChIKey of (1S,4R)-4-[(2S,3S)-3-iodooxolan-2-yl]oxycyclopent-2-en-1-ol?
The InChIKey is JRSACPLAGJWACT-XGEHTFHBSA-N. The full InChI is InChI=1S/C9H13IO3/c10-8-3-4-12-9(8)13-7-2-1-6(11)5-7/h1-2,6-9,11H,3-5H2/t6-,7+,8+,9+/m1/s1.
What are the key properties of (1S,4R)-4-[(2S,3S)-3-iodooxolan-2-yl]oxycyclopent-2-en-1-ol?
(1S,4R)-4-[(2S,3S)-3-iodooxolan-2-yl]oxycyclopent-2-en-1-ol has a molecular weight of 296.10 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4R)-4-[(2S,3S)-3-iodooxolan-2-yl]oxycyclopent-2-en-1-ol is sourced from PubChem (CID 66634577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).