C21H29F2N4O6P — CID 66634716
[4-[[2-amino-5-[[4-(2-ethoxy-2-oxoethyl)-2-methoxyphenyl]methyl]-6-methylpyrimidin-4-yl]amino]-1,1-difluorobutyl]phosphonic acid (PubChem CID 66634716) has the molecular formula C21H29F2N4O6P and a molecular weight of 502.46 g/mol. Its IUPAC name is [4-[[2-amino-5-[[4-(2-ethoxy-2-oxoethyl)-2-methoxyphenyl]methyl]-6-methylpyrimidin-4-yl]amino]-1,1-difluorobutyl]phosphonic acid.
| Compound Name | [4-[[2-amino-5-[[4-(2-ethoxy-2-oxoethyl)-2-methoxyphenyl]methyl]-6-methylpyrimidin-4-yl]amino]-1,1-difluorobutyl]phosphonic acid |
|---|---|
| PubChem CID | 66634716 |
| Molecular Formula | C21H29F2N4O6P |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | [4-[[2-amino-5-[[4-(2-ethoxy-2-oxoethyl)-2-methoxyphenyl]methyl]-6-methylpyrimidin-4-yl]amino]-1,1-difluorobutyl]phosphonic acid |
| SMILES | CCOC(=O)Cc1ccc(Cc2c(C)nc(N)nc2NCCCC(F)(F)P(=O)(O)O)c(OC)c1 |
| InChI | InChI=1S/C21H29F2N4O6P/c1-4-33-18(28)11-14-6-7-15(17(10-14)32-3)12-16-13(2)26-20(24)27-19(16)25-9-5-8-21(22,23)34(29,30)31/h6-7,10H,4-5,8-9,11-12H2,1-3H3,(H2,29,30,31)(H3,24,25,26,27) |
| InChIKey | LASUZTPSLWNFAG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 156.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|