About N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide
N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide (PubChem CID 66635138) has the molecular formula C24H24N2O3
and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide |
| PubChem CID | 66635138 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide |
| SMILES | CCOc1ccc(C#Cc2ccc(CC(C)NC(=O)c3ocnc3C)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O3/c1-4-28-22-13-11-20(12-14-22)6-5-19-7-9-21(10-8-19)15-17(2)26-24(27)23-18(3)25-16-29-23/h7-14,16-17H,4,15H2,1-3H3,(H,26,27) |
| InChIKey | HREVHHSTUJLVBP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide?
The IUPAC name of N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide (CID 66635138) is N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide.
What is the SMILES notation for N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide?
The canonical SMILES for N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide is CCOc1ccc(C#Cc2ccc(CC(C)NC(=O)c3ocnc3C)cc2)cc1.
What is the InChIKey of N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide?
The InChIKey is HREVHHSTUJLVBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N2O3/c1-4-28-22-13-11-20(12-14-22)6-5-19-7-9-21(10-8-19)15-17(2)26-24(27)23-18(3)25-16-29-23/h7-14,16-17H,4,15H2,1-3H3,(H,26,27).
What are the key properties of N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide?
N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide has a molecular weight of 388.47 g/mol, XLogP of 4.14, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide is sourced from PubChem (CID 66635138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).