C24H28N2O2 — CID 66635147
N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]pyrrolidine-3-carboxamide (PubChem CID 66635147) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]pyrrolidine-3-carboxamide.
| Compound Name | N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 66635147 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | N-[1-[4-[2-(4-ethoxyphenyl)ethynyl]phenyl]propan-2-yl]pyrrolidine-3-carboxamide |
| SMILES | CCOc1ccc(C#Cc2ccc(CC(C)NC(=O)C3CCNC3)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O2/c1-3-28-23-12-10-20(11-13-23)5-4-19-6-8-21(9-7-19)16-18(2)26-24(27)22-14-15-25-17-22/h6-13,18,22,25H,3,14-17H2,1-2H3,(H,26,27) |
| InChIKey | BECYURGHQXMVCO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|