C25H25F3N4O2 — CID 66635622
2-phenylmethoxy-4-(piperidin-1-ylmethyl)-N-pyridazin-4-yl-5-(trifluoromethyl)benzamide (PubChem CID 66635622) has the molecular formula C25H25F3N4O2 and a molecular weight of 470.50 g/mol. Its IUPAC name is 2-phenylmethoxy-4-(piperidin-1-ylmethyl)-N-pyridazin-4-yl-5-(trifluoromethyl)benzamide.
| Compound Name | 2-phenylmethoxy-4-(piperidin-1-ylmethyl)-N-pyridazin-4-yl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 66635622 |
| Molecular Formula | C25H25F3N4O2 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 2-phenylmethoxy-4-(piperidin-1-ylmethyl)-N-pyridazin-4-yl-5-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccnnc1)c1cc(C(F)(F)F)c(CN2CCCCC2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C25H25F3N4O2/c26-25(27,28)22-14-21(24(33)31-20-9-10-29-30-15-20)23(34-17-18-7-3-1-4-8-18)13-19(22)16-32-11-5-2-6-12-32/h1,3-4,7-10,13-15H,2,5-6,11-12,16-17H2,(H,29,31,33) |
| InChIKey | ZGBITSVINYLREK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |