About [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylphenyl]-(2-fluorophenyl)methanone
[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylphenyl]-(2-fluorophenyl)methanone (PubChem CID 66635808) has the molecular formula C19H18FNO2
and a molecular weight of 311.36 g/mol. Its IUPAC name is [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylphenyl]-(2-fluorophenyl)methanone.
Molecular Properties
| Compound Name | [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylphenyl]-(2-fluorophenyl)methanone |
| PubChem CID | 66635808 |
| Molecular Formula | C19H18FNO2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylphenyl]-(2-fluorophenyl)methanone |
| SMILES | Cc1cc(C(=O)c2ccccc2F)ccc1C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C19H18FNO2/c1-12-10-13(17(22)15-6-4-5-7-16(15)20)8-9-14(12)18-21-19(2,3)11-23-18/h4-10H,11H2,1-3H3 |
| InChIKey | GTIKQNLDAIFYKE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylphenyl]-(2-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylphenyl]-(2-fluorophenyl)methanone?
The IUPAC name of [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylphenyl]-(2-fluorophenyl)methanone (CID 66635808) is [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylphenyl]-(2-fluorophenyl)methanone.
What is the SMILES notation for [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylphenyl]-(2-fluorophenyl)methanone?
The canonical SMILES for [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylphenyl]-(2-fluorophenyl)methanone is Cc1cc(C(=O)c2ccccc2F)ccc1C1=NC(C)(C)CO1.
What is the InChIKey of [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylphenyl]-(2-fluorophenyl)methanone?
The InChIKey is GTIKQNLDAIFYKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18FNO2/c1-12-10-13(17(22)15-6-4-5-7-16(15)20)8-9-14(12)18-21-19(2,3)11-23-18/h4-10H,11H2,1-3H3.
What are the key properties of [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylphenyl]-(2-fluorophenyl)methanone?
[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylphenyl]-(2-fluorophenyl)methanone has a molecular weight of 311.36 g/mol, XLogP of 3.92, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methylphenyl]-(2-fluorophenyl)methanone is sourced from PubChem (CID 66635808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).