C21H27BFNO3 — CID 66635911
(2R)-1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3-phenylpropan-2-amine (PubChem CID 66635911) has the molecular formula C21H27BFNO3 and a molecular weight of 371.26 g/mol. Its IUPAC name is (2R)-1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3-phenylpropan-2-amine.
| Compound Name | (2R)-1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3-phenylpropan-2-amine |
|---|---|
| PubChem CID | 66635911 |
| Molecular Formula | C21H27BFNO3 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (2R)-1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3-phenylpropan-2-amine |
| SMILES | CC1(C)OB(c2ccc(OC[C@H](N)Cc3ccccc3)cc2F)OC1(C)C |
| InChI | InChI=1S/C21H27BFNO3/c1-20(2)21(3,4)27-22(26-20)18-11-10-17(13-19(18)23)25-14-16(24)12-15-8-6-5-7-9-15/h5-11,13,16H,12,14,24H2,1-4H3/t16-/m1/s1 |
| InChIKey | JGNNGYBFMHNVEX-MRXNPFEDSA-N |
| XLogP | 3.07 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|