About 5,8-dimethyl-2-[(E)-2-(1-methyl-4-phenylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrazine
5,8-dimethyl-2-[(E)-2-(1-methyl-4-phenylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrazine (PubChem CID 66636089) has the molecular formula C20H19N5
and a molecular weight of 329.41 g/mol. Its IUPAC name is 5,8-dimethyl-2-[(E)-2-(1-methyl-4-phenylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 5,8-dimethyl-2-[(E)-2-(1-methyl-4-phenylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrazine |
| PubChem CID | 66636089 |
| Molecular Formula | C20H19N5 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 5,8-dimethyl-2-[(E)-2-(1-methyl-4-phenylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrazine |
| SMILES | Cc1ncc(C)n2cc(/C=C/c3nc(-c4ccccc4)cn3C)nc12 |
| InChI | InChI=1S/C20H19N5/c1-14-11-21-15(2)20-22-17(12-25(14)20)9-10-19-23-18(13-24(19)3)16-7-5-4-6-8-16/h4-13H,1-3H3/b10-9+ |
| InChIKey | NTJVFLOKYBVKIF-MDZDMXLPSA-N |
| XLogP | 3.92 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze 5,8-dimethyl-2-[(E)-2-(1-methyl-4-phenylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dimethyl-2-[(E)-2-(1-methyl-4-phenylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrazine?
The IUPAC name of 5,8-dimethyl-2-[(E)-2-(1-methyl-4-phenylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrazine (CID 66636089) is 5,8-dimethyl-2-[(E)-2-(1-methyl-4-phenylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrazine.
What is the SMILES notation for 5,8-dimethyl-2-[(E)-2-(1-methyl-4-phenylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrazine?
The canonical SMILES for 5,8-dimethyl-2-[(E)-2-(1-methyl-4-phenylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrazine is Cc1ncc(C)n2cc(/C=C/c3nc(-c4ccccc4)cn3C)nc12.
What is the InChIKey of 5,8-dimethyl-2-[(E)-2-(1-methyl-4-phenylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrazine?
The InChIKey is NTJVFLOKYBVKIF-MDZDMXLPSA-N. The full InChI is InChI=1S/C20H19N5/c1-14-11-21-15(2)20-22-17(12-25(14)20)9-10-19-23-18(13-24(19)3)16-7-5-4-6-8-16/h4-13H,1-3H3/b10-9+.
What are the key properties of 5,8-dimethyl-2-[(E)-2-(1-methyl-4-phenylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrazine?
5,8-dimethyl-2-[(E)-2-(1-methyl-4-phenylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrazine has a molecular weight of 329.41 g/mol, XLogP of 3.92, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dimethyl-2-[(E)-2-(1-methyl-4-phenylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrazine is sourced from PubChem (CID 66636089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).