C29H28ClN5O3S — CID 66636363
5-(4-chlorophenyl)-3-[[3-[1-[4-(morpholin-4-ylmethyl)-1H-pyrrol-2-yl]ethylidene]-2-oxo-1H-indol-5-yl]methyl]-6H-1,3,4-thiadiazin-2-one (PubChem CID 66636363) has the molecular formula C29H28ClN5O3S and a molecular weight of 562.10 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[[3-[1-[4-(morpholin-4-ylmethyl)-1H-pyrrol-2-yl]ethylidene]-2-oxo-1H-indol-5-yl]methyl]-6H-1,3,4-thiadiazin-2-one.
| Compound Name | 5-(4-chlorophenyl)-3-[[3-[1-[4-(morpholin-4-ylmethyl)-1H-pyrrol-2-yl]ethylidene]-2-oxo-1H-indol-5-yl]methyl]-6H-1,3,4-thiadiazin-2-one |
|---|---|
| PubChem CID | 66636363 |
| Molecular Formula | C29H28ClN5O3S |
| Molecular Weight | 562.10 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[[3-[1-[4-(morpholin-4-ylmethyl)-1H-pyrrol-2-yl]ethylidene]-2-oxo-1H-indol-5-yl]methyl]-6H-1,3,4-thiadiazin-2-one |
| SMILES | CC(=C1C(=O)Nc2ccc(CN3N=C(c4ccc(Cl)cc4)CSC3=O)cc21)c1cc(CN2CCOCC2)c[nH]1 |
| InChI | InChI=1S/C29H28ClN5O3S/c1-18(25-13-20(14-31-25)15-34-8-10-38-11-9-34)27-23-12-19(2-7-24(23)32-28(27)36)16-35-29(37)39-17-26(33-35)21-3-5-22(30)6-4-21/h2-7,12-14,31H,8-11,15-17H2,1H3,(H,32,36) |
| InChIKey | JNFXIHSPRQPZFV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.10 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|