C14H11ClN4O3 — CID 66636837
4'-chloro-6-nitrospiro[1,3,3a,4-tetrahydroindene-2,5'-7H-pyrrolo[2,3-d]pyrimidine]-6'-one (PubChem CID 66636837) has the molecular formula C14H11ClN4O3 and a molecular weight of 318.72 g/mol. Its IUPAC name is 4'-chloro-6-nitrospiro[1,3,3a,4-tetrahydroindene-2,5'-7H-pyrrolo[2,3-d]pyrimidine]-6'-one.
| Compound Name | 4'-chloro-6-nitrospiro[1,3,3a,4-tetrahydroindene-2,5'-7H-pyrrolo[2,3-d]pyrimidine]-6'-one |
|---|---|
| PubChem CID | 66636837 |
| Molecular Formula | C14H11ClN4O3 |
| Molecular Weight | 318.72 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 4'-chloro-6-nitrospiro[1,3,3a,4-tetrahydroindene-2,5'-7H-pyrrolo[2,3-d]pyrimidine]-6'-one |
| SMILES | O=C1Nc2ncnc(Cl)c2C12CC1=CC([N+](=O)[O-])=CCC1C2 |
| InChI | InChI=1S/C14H11ClN4O3/c15-11-10-12(17-6-16-11)18-13(20)14(10)4-7-1-2-9(19(21)22)3-8(7)5-14/h2-3,6-7H,1,4-5H2,(H,16,17,18,20) |
| InChIKey | MFWILQMMWXBMOC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.72 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|