C18H15NO4 — CID 66636870
2-(9,10-dioxo-7,8-dihydro-6H-indeno[1,2-b]indol-5-yl)propanoic acid (PubChem CID 66636870) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-(9,10-dioxo-7,8-dihydro-6H-indeno[1,2-b]indol-5-yl)propanoic acid.
| Compound Name | 2-(9,10-dioxo-7,8-dihydro-6H-indeno[1,2-b]indol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 66636870 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-(9,10-dioxo-7,8-dihydro-6H-indeno[1,2-b]indol-5-yl)propanoic acid |
| SMILES | CC(C(=O)O)n1c2c(c3c1-c1ccccc1C3=O)C(=O)CCC2 |
| InChI | InChI=1S/C18H15NO4/c1-9(18(22)23)19-12-7-4-8-13(20)14(12)15-16(19)10-5-2-3-6-11(10)17(15)21/h2-3,5-6,9H,4,7-8H2,1H3,(H,22,23) |
| InChIKey | BABVRXOPKDLQNT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |