About 1-cyclobutylethanamine;hydrochloride
1-cyclobutylethanamine;hydrochloride (PubChem CID 66636997) has the molecular formula C6H14ClN
and a molecular weight of 135.64 g/mol. Its IUPAC name is 1-cyclobutylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-cyclobutylethanamine;hydrochloride |
| PubChem CID | 66636997 |
| Molecular Formula | C6H14ClN |
| Molecular Weight | 135.64 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 1-cyclobutylethanamine;hydrochloride |
| SMILES | CC(N)C1CCC1.Cl |
| InChI | InChI=1S/C6H13N.ClH/c1-5(7)6-3-2-4-6;/h5-6H,2-4,7H2,1H3;1H |
| InChIKey | WLHYWKUHCPUOOO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.64 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclobutylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutylethanamine;hydrochloride?
The IUPAC name of 1-cyclobutylethanamine;hydrochloride (CID 66636997) is 1-cyclobutylethanamine;hydrochloride.
What is the SMILES notation for 1-cyclobutylethanamine;hydrochloride?
The canonical SMILES for 1-cyclobutylethanamine;hydrochloride is CC(N)C1CCC1.Cl.
What is the InChIKey of 1-cyclobutylethanamine;hydrochloride?
The InChIKey is WLHYWKUHCPUOOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.ClH/c1-5(7)6-3-2-4-6;/h5-6H,2-4,7H2,1H3;1H.
What are the key properties of 1-cyclobutylethanamine;hydrochloride?
1-cyclobutylethanamine;hydrochloride has a molecular weight of 135.64 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutylethanamine;hydrochloride is sourced from PubChem (CID 66636997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).